C15H34O2 — CID 175249202
1,3-dimethoxypropane;2,3,3,5-tetramethylhexane (PubChem CID 175249202) has the molecular formula C15H34O2 and a molecular weight of 246.43 g/mol. Its IUPAC name is 1,3-dimethoxypropane;2,3,3,5-tetramethylhexane.
| Compound Name | 1,3-dimethoxypropane;2,3,3,5-tetramethylhexane |
|---|---|
| PubChem CID | 175249202 |
| Molecular Formula | C15H34O2 |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.26 |
| IUPAC Name | 1,3-dimethoxypropane;2,3,3,5-tetramethylhexane |
| SMILES | CC(C)CC(C)(C)C(C)C.COCCCOC |
| InChI | InChI=1S/C10H22.C5H12O2/c1-8(2)7-10(5,6)9(3)4;1-6-4-3-5-7-2/h8-9H,7H2,1-6H3;3-5H2,1-2H3 |
| InChIKey | GSOSFXJPTVOWHW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|