C17H38N2O2 — CID 114867556
2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine (PubChem CID 114867556) has the molecular formula C17H38N2O2 and a molecular weight of 302.50 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 114867556 |
| Molecular Formula | C17H38N2O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.29 |
| IUPAC Name | 2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine |
| SMILES | COCCCN(CCOC)C(CN)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C17H38N2O2/c1-15(2)12-17(14-18,13-16(3)4)19(9-11-21-6)8-7-10-20-5/h15-16H,7-14,18H2,1-6H3 |
| InChIKey | CEPUUJVWYLONQN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|