C15H34N2O3 — CID 104561127
2-N,2-diethyl-2-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]butane-1,2-diamine (PubChem CID 104561127) has the molecular formula C15H34N2O3 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-N,2-diethyl-2-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]butane-1,2-diamine.
| Compound Name | 2-N,2-diethyl-2-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 104561127 |
| Molecular Formula | C15H34N2O3 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 2-N,2-diethyl-2-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]butane-1,2-diamine |
| SMILES | CCN(CCOCCOCCOC)C(CC)(CC)CN |
| InChI | InChI=1S/C15H34N2O3/c1-5-15(6-2,14-16)17(7-3)8-9-19-12-13-20-11-10-18-4/h5-14,16H2,1-4H3 |
| InChIKey | LVGDSUCGSAIGPW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|