C19H37NO — CID 3268041
2-hydroxy-2,6,10,14-tetramethylpentadecanenitrile (PubChem CID 3268041) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is 2-hydroxy-2,6,10,14-tetramethylpentadecanenitrile.
| Compound Name | 2-hydroxy-2,6,10,14-tetramethylpentadecanenitrile |
|---|---|
| PubChem CID | 3268041 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | 2-hydroxy-2,6,10,14-tetramethylpentadecanenitrile |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)(O)C#N |
| InChI | InChI=1S/C19H37NO/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5,21)15-20/h16-18,21H,6-14H2,1-5H3 |
| InChIKey | DRBQMRYLEYMXTH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|