C20H42O2 — CID 118520250
2,2-dimethoxy-6,10,14-trimethylpentadecane (PubChem CID 118520250) has the molecular formula C20H42O2 and a molecular weight of 314.55 g/mol. Its IUPAC name is 2,2-dimethoxy-6,10,14-trimethylpentadecane.
| Compound Name | 2,2-dimethoxy-6,10,14-trimethylpentadecane |
|---|---|
| PubChem CID | 118520250 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | 2,2-dimethoxy-6,10,14-trimethylpentadecane |
| SMILES | COC(C)(CCCC(C)CCCC(C)CCCC(C)C)OC |
| InChI | InChI=1S/C20H42O2/c1-17(2)11-8-12-18(3)13-9-14-19(4)15-10-16-20(5,21-6)22-7/h17-19H,8-16H2,1-7H3 |
| InChIKey | OINAUZAZTSKBGK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|