C21H44O — CID 91173941
14-methoxy-2,6,10,14-tetramethylhexadecane (PubChem CID 91173941) has the molecular formula C21H44O and a molecular weight of 312.58 g/mol. Its IUPAC name is 14-methoxy-2,6,10,14-tetramethylhexadecane.
| Compound Name | 14-methoxy-2,6,10,14-tetramethylhexadecane |
|---|---|
| PubChem CID | 91173941 |
| Molecular Formula | C21H44O |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 312.34 |
| IUPAC Name | 14-methoxy-2,6,10,14-tetramethylhexadecane |
| SMILES | CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)OC |
| InChI | InChI=1S/C21H44O/c1-8-21(6,22-7)17-11-16-20(5)15-10-14-19(4)13-9-12-18(2)3/h18-20H,8-17H2,1-7H3 |
| InChIKey | RLWLPYSUCPLWES-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |