C18H38 — CID 164934007
2,2,7,13-tetramethyltetradecane (PubChem CID 164934007) has the molecular formula C18H38 and a molecular weight of 254.50 g/mol. Its IUPAC name is 2,2,7,13-tetramethyltetradecane.
| Compound Name | 2,2,7,13-tetramethyltetradecane |
|---|---|
| PubChem CID | 164934007 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 2,2,7,13-tetramethyltetradecane |
| SMILES | CC(C)CCCCCC(C)CCCCC(C)(C)C |
| InChI | InChI=1S/C18H38/c1-16(2)12-8-7-9-13-17(3)14-10-11-15-18(4,5)6/h16-17H,7-15H2,1-6H3 |
| InChIKey | JZZTZXIWSNMLHI-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|