C17H36O — CID 118887775
(6R)-6-methoxy-2,2,12-trimethyltridecane (PubChem CID 118887775) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is (6R)-6-methoxy-2,2,12-trimethyltridecane.
| Compound Name | (6R)-6-methoxy-2,2,12-trimethyltridecane |
|---|---|
| PubChem CID | 118887775 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | (6R)-6-methoxy-2,2,12-trimethyltridecane |
| SMILES | CO[C@H](CCCCCC(C)C)CCCC(C)(C)C |
| InChI | InChI=1S/C17H36O/c1-15(2)11-8-7-9-12-16(18-6)13-10-14-17(3,4)5/h15-16H,7-14H2,1-6H3/t16-/m1/s1 |
| InChIKey | APJMNEXFVDOXHH-MRXNPFEDSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|