C18H38N2O — CID 118887718
1-[(5R)-5-methoxy-9,9-dimethyldecyl]-4-methylpiperazine (PubChem CID 118887718) has the molecular formula C18H38N2O and a molecular weight of 298.51 g/mol. Its IUPAC name is 1-[(5R)-5-methoxy-9,9-dimethyldecyl]-4-methylpiperazine.
| Compound Name | 1-[(5R)-5-methoxy-9,9-dimethyldecyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 118887718 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | 1-[(5R)-5-methoxy-9,9-dimethyldecyl]-4-methylpiperazine |
| SMILES | CO[C@@H](CCCCN1CCN(C)CC1)CCCC(C)(C)C |
| InChI | InChI=1S/C18H38N2O/c1-18(2,3)11-8-10-17(21-5)9-6-7-12-20-15-13-19(4)14-16-20/h17H,6-16H2,1-5H3/t17-/m0/s1 |
| InChIKey | AGWULOWBPMTHID-KRWDZBQOSA-N |
| XLogP | 3.64 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|