About 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine
1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine (PubChem CID 118887650) has the molecular formula C17H36N2O
and a molecular weight of 284.49 g/mol. Its IUPAC name is 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine |
| PubChem CID | 118887650 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine |
| SMILES | CO[C@H](CCCN1CCN(C)CC1)CCCC(C)(C)C |
| InChI | InChI=1S/C17H36N2O/c1-17(2,3)10-6-8-16(20-5)9-7-11-19-14-12-18(4)13-15-19/h16H,6-15H2,1-5H3/t16-/m0/s1 |
| InChIKey | NHJBRHBVZFLFTC-INIZCTEOSA-N |
| XLogP | 3.25 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine?
The IUPAC name of 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine (CID 118887650) is 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine.
What is the SMILES notation for 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine?
The canonical SMILES for 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine is CO[C@H](CCCN1CCN(C)CC1)CCCC(C)(C)C.
What is the InChIKey of 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine?
The InChIKey is NHJBRHBVZFLFTC-INIZCTEOSA-N. The full InChI is InChI=1S/C17H36N2O/c1-17(2,3)10-6-8-16(20-5)9-7-11-19-14-12-18(4)13-15-19/h16H,6-15H2,1-5H3/t16-/m0/s1.
What are the key properties of 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine?
1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine has a molecular weight of 284.49 g/mol, XLogP of 3.25, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-4-methoxy-8,8-dimethylnonyl]-4-methylpiperazine is sourced from PubChem (CID 118887650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).