About (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol
(3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol (PubChem CID 118887623) has the molecular formula C18H38N2O
and a molecular weight of 298.52 g/mol. Its IUPAC name is (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol.
Molecular Properties
| Compound Name | (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol |
| PubChem CID | 118887623 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol |
| SMILES | CN1CCN(CCCCC[C@H](CCO)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H38N2O/c1-18(2,3)16-17(9-15-21)8-6-5-7-10-20-13-11-19(4)12-14-20/h17,21H,5-16H2,1-4H3/t17-/m1/s1 |
| InChIKey | WDJMYZUUNWUCCZ-QGZVFWFLSA-N |
| XLogP | 3.23 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol?
The IUPAC name of (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol (CID 118887623) is (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol.
What is the SMILES notation for (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol?
The canonical SMILES for (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol is CN1CCN(CCCCC[C@H](CCO)CC(C)(C)C)CC1.
What is the InChIKey of (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol?
The InChIKey is WDJMYZUUNWUCCZ-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H38N2O/c1-18(2,3)16-17(9-15-21)8-6-5-7-10-20-13-11-19(4)12-14-20/h17,21H,5-16H2,1-4H3/t17-/m1/s1.
What are the key properties of (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol?
(3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol has a molecular weight of 298.52 g/mol, XLogP of 3.23, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(2,2-dimethylpropyl)-8-(4-methylpiperazin-1-yl)octan-1-ol is sourced from PubChem (CID 118887623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).