C14H31NO — CID 118887513
(3S)-7-(dimethylamino)-3-(2,2-dimethylpropyl)heptan-1-ol (PubChem CID 118887513) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is (3S)-7-(dimethylamino)-3-(2,2-dimethylpropyl)heptan-1-ol.
| Compound Name | (3S)-7-(dimethylamino)-3-(2,2-dimethylpropyl)heptan-1-ol |
|---|---|
| PubChem CID | 118887513 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | (3S)-7-(dimethylamino)-3-(2,2-dimethylpropyl)heptan-1-ol |
| SMILES | CN(C)CCCC[C@H](CCO)CC(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-14(2,3)12-13(9-11-16)8-6-7-10-15(4)5/h13,16H,6-12H2,1-5H3/t13-/m1/s1 |
| InChIKey | YGBSPNGJKRSSLZ-CYBMUJFWSA-N |
| XLogP | 3.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|