About (3R)-3-(2,2-dimethylpropyl)octan-1-ol
(3R)-3-(2,2-dimethylpropyl)octan-1-ol (PubChem CID 118887517) has the molecular formula C13H28O
and a molecular weight of 200.37 g/mol. Its IUPAC name is (3R)-3-(2,2-dimethylpropyl)octan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-(2,2-dimethylpropyl)octan-1-ol |
| PubChem CID | 118887517 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | (3R)-3-(2,2-dimethylpropyl)octan-1-ol |
| SMILES | CCCCC[C@@H](CCO)CC(C)(C)C |
| InChI | InChI=1S/C13H28O/c1-5-6-7-8-12(9-10-14)11-13(2,3)4/h12,14H,5-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | SOVZEAXNHZTTSE-LBPRGKRZSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(2,2-dimethylpropyl)octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(2,2-dimethylpropyl)octan-1-ol?
The IUPAC name of (3R)-3-(2,2-dimethylpropyl)octan-1-ol (CID 118887517) is (3R)-3-(2,2-dimethylpropyl)octan-1-ol.
What is the SMILES notation for (3R)-3-(2,2-dimethylpropyl)octan-1-ol?
The canonical SMILES for (3R)-3-(2,2-dimethylpropyl)octan-1-ol is CCCCC[C@@H](CCO)CC(C)(C)C.
What is the InChIKey of (3R)-3-(2,2-dimethylpropyl)octan-1-ol?
The InChIKey is SOVZEAXNHZTTSE-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H28O/c1-5-6-7-8-12(9-10-14)11-13(2,3)4/h12,14H,5-11H2,1-4H3/t12-/m0/s1.
What are the key properties of (3R)-3-(2,2-dimethylpropyl)octan-1-ol?
(3R)-3-(2,2-dimethylpropyl)octan-1-ol has a molecular weight of 200.37 g/mol, XLogP of 4.00, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(2,2-dimethylpropyl)octan-1-ol is sourced from PubChem (CID 118887517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).