C19H40N2O — CID 118887619
(3S)-3-(2,2-dimethylpropyl)-8-(4-ethylpiperazin-1-yl)octan-1-ol (PubChem CID 118887619) has the molecular formula C19H40N2O and a molecular weight of 312.54 g/mol. Its IUPAC name is (3S)-3-(2,2-dimethylpropyl)-8-(4-ethylpiperazin-1-yl)octan-1-ol.
| Compound Name | (3S)-3-(2,2-dimethylpropyl)-8-(4-ethylpiperazin-1-yl)octan-1-ol |
|---|---|
| PubChem CID | 118887619 |
| Molecular Formula | C19H40N2O |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.31 |
| IUPAC Name | (3S)-3-(2,2-dimethylpropyl)-8-(4-ethylpiperazin-1-yl)octan-1-ol |
| SMILES | CCN1CCN(CCCCC[C@H](CCO)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H40N2O/c1-5-20-12-14-21(15-13-20)11-8-6-7-9-18(10-16-22)17-19(2,3)4/h18,22H,5-17H2,1-4H3/t18-/m1/s1 |
| InChIKey | BRTCQAWGKKOVLU-GOSISDBHSA-N |
| XLogP | 3.62 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|