C14H31N — CID 118887657
(4S)-4-ethyl-N,N,7,7-tetramethyloctan-1-amine (PubChem CID 118887657) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is (4S)-4-ethyl-N,N,7,7-tetramethyloctan-1-amine.
| Compound Name | (4S)-4-ethyl-N,N,7,7-tetramethyloctan-1-amine |
|---|---|
| PubChem CID | 118887657 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | (4S)-4-ethyl-N,N,7,7-tetramethyloctan-1-amine |
| SMILES | CC[C@H](CCCN(C)C)CCC(C)(C)C |
| InChI | InChI=1S/C14H31N/c1-7-13(9-8-12-15(5)6)10-11-14(2,3)4/h13H,7-12H2,1-6H3/t13-/m1/s1 |
| InChIKey | OAAVVDIHOWIDKI-CYBMUJFWSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |