C16H34 — CID 157105314
4-ethyl-2,2,9,9-tetramethyldecane (PubChem CID 157105314) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is 4-ethyl-2,2,9,9-tetramethyldecane.
| Compound Name | 4-ethyl-2,2,9,9-tetramethyldecane |
|---|---|
| PubChem CID | 157105314 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 4-ethyl-2,2,9,9-tetramethyldecane |
| SMILES | CCC(CCCCC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C16H34/c1-8-14(13-16(5,6)7)11-9-10-12-15(2,3)4/h14H,8-13H2,1-7H3 |
| InChIKey | AGFNYMVTBBKWDH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|