C20H42O — CID 129034366
2-(6,6-dimethylheptyl)-8,8-dimethylnonan-1-ol (PubChem CID 129034366) has the molecular formula C20H42O and a molecular weight of 298.55 g/mol. Its IUPAC name is 2-(6,6-dimethylheptyl)-8,8-dimethylnonan-1-ol.
| Compound Name | 2-(6,6-dimethylheptyl)-8,8-dimethylnonan-1-ol |
|---|---|
| PubChem CID | 129034366 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 2-(6,6-dimethylheptyl)-8,8-dimethylnonan-1-ol |
| SMILES | CC(C)(C)CCCCCC(CO)CCCCCC(C)(C)C |
| InChI | InChI=1S/C20H42O/c1-19(2,3)15-11-7-9-13-18(17-21)14-10-8-12-16-20(4,5)6/h18,21H,7-17H2,1-6H3 |
| InChIKey | BUMBJXOXNSYSIU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|