About (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol
(2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol (PubChem CID 118887577) has the molecular formula C18H39NO
and a molecular weight of 285.52 g/mol. Its IUPAC name is (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol |
| PubChem CID | 118887577 |
| Molecular Formula | C18H39NO |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.30 |
| IUPAC Name | (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol |
| SMILES | CC(C)(C)CC[C@H](CO)CCCCCNCC(C)(C)C |
| InChI | InChI=1S/C18H39NO/c1-17(2,3)12-11-16(14-20)10-8-7-9-13-19-15-18(4,5)6/h16,19-20H,7-15H2,1-6H3/t16-/m1/s1 |
| InChIKey | NZOZJQGGUOGOPV-MRXNPFEDSA-N |
| XLogP | 4.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol?
The IUPAC name of (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol (CID 118887577) is (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol.
What is the SMILES notation for (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol?
The canonical SMILES for (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol is CC(C)(C)CC[C@H](CO)CCCCCNCC(C)(C)C.
What is the InChIKey of (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol?
The InChIKey is NZOZJQGGUOGOPV-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H39NO/c1-17(2,3)12-11-16(14-20)10-8-7-9-13-19-15-18(4,5)6/h16,19-20H,7-15H2,1-6H3/t16-/m1/s1.
What are the key properties of (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol?
(2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol has a molecular weight of 285.52 g/mol, XLogP of 4.62, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,3-dimethylbutyl)-7-(2,2-dimethylpropylamino)heptan-1-ol is sourced from PubChem (CID 118887577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).