C15H33NO — CID 118890289
(5R)-N-(2,2-dimethylpropyl)-5-(methoxymethyl)octan-1-amine (PubChem CID 118890289) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is (5R)-N-(2,2-dimethylpropyl)-5-(methoxymethyl)octan-1-amine.
| Compound Name | (5R)-N-(2,2-dimethylpropyl)-5-(methoxymethyl)octan-1-amine |
|---|---|
| PubChem CID | 118890289 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | (5R)-N-(2,2-dimethylpropyl)-5-(methoxymethyl)octan-1-amine |
| SMILES | CCC[C@H](CCCCNCC(C)(C)C)COC |
| InChI | InChI=1S/C15H33NO/c1-6-9-14(12-17-5)10-7-8-11-16-13-15(2,3)4/h14,16H,6-13H2,1-5H3/t14-/m1/s1 |
| InChIKey | ZFVRVFKABZALMX-CQSZACIVSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|