About ethane;4-(methoxymethyl)heptane;propane
ethane;4-(methoxymethyl)heptane;propane (PubChem CID 168880885) has the molecular formula C14H34O
and a molecular weight of 218.42 g/mol. Its IUPAC name is ethane;4-(methoxymethyl)heptane;propane.
Molecular Properties
| Compound Name | ethane;4-(methoxymethyl)heptane;propane |
| PubChem CID | 168880885 |
| Molecular Formula | C14H34O |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 218.26 |
| IUPAC Name | ethane;4-(methoxymethyl)heptane;propane |
| SMILES | CC.CCC.CCCC(CCC)COC |
| InChI | InChI=1S/C9H20O.C3H8.C2H6/c1-4-6-9(7-5-2)8-10-3;1-3-2;1-2/h9H,4-8H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | JQIHSRLAFKGTAR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-(methoxymethyl)heptane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(methoxymethyl)heptane;propane?
The IUPAC name of ethane;4-(methoxymethyl)heptane;propane (CID 168880885) is ethane;4-(methoxymethyl)heptane;propane.
What is the SMILES notation for ethane;4-(methoxymethyl)heptane;propane?
The canonical SMILES for ethane;4-(methoxymethyl)heptane;propane is CC.CCC.CCCC(CCC)COC.
What is the InChIKey of ethane;4-(methoxymethyl)heptane;propane?
The InChIKey is JQIHSRLAFKGTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O.C3H8.C2H6/c1-4-6-9(7-5-2)8-10-3;1-3-2;1-2/h9H,4-8H2,1-3H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;4-(methoxymethyl)heptane;propane?
ethane;4-(methoxymethyl)heptane;propane has a molecular weight of 218.42 g/mol, XLogP of 5.29, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(methoxymethyl)heptane;propane is sourced from PubChem (CID 168880885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).