About 4-(ethenoxymethyl)nonane
4-(ethenoxymethyl)nonane (PubChem CID 54548682) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 4-(ethenoxymethyl)nonane.
Molecular Properties
| Compound Name | 4-(ethenoxymethyl)nonane |
| PubChem CID | 54548682 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 4-(ethenoxymethyl)nonane |
| SMILES | C=COCC(CCC)CCCCC |
| InChI | InChI=1S/C12H24O/c1-4-7-8-10-12(9-5-2)11-13-6-3/h6,12H,3-5,7-11H2,1-2H3 |
| InChIKey | CBGGSJXBIHWBIR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethenoxymethyl)nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethenoxymethyl)nonane?
The IUPAC name of 4-(ethenoxymethyl)nonane (CID 54548682) is 4-(ethenoxymethyl)nonane.
What is the SMILES notation for 4-(ethenoxymethyl)nonane?
The canonical SMILES for 4-(ethenoxymethyl)nonane is C=COCC(CCC)CCCCC.
What is the InChIKey of 4-(ethenoxymethyl)nonane?
The InChIKey is CBGGSJXBIHWBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O/c1-4-7-8-10-12(9-5-2)11-13-6-3/h6,12H,3-5,7-11H2,1-2H3.
What are the key properties of 4-(ethenoxymethyl)nonane?
4-(ethenoxymethyl)nonane has a molecular weight of 184.32 g/mol, XLogP of 4.14, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethenoxymethyl)nonane is sourced from PubChem (CID 54548682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).