About 4-(ethoxymethyl)nonane
4-(ethoxymethyl)nonane (PubChem CID 87066523) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is 4-(ethoxymethyl)nonane.
Molecular Properties
| Compound Name | 4-(ethoxymethyl)nonane |
| PubChem CID | 87066523 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 4-(ethoxymethyl)nonane |
| SMILES | CCCCCC(CCC)COCC |
| InChI | InChI=1S/C12H26O/c1-4-7-8-10-12(9-5-2)11-13-6-3/h12H,4-11H2,1-3H3 |
| InChIKey | NCUQUVAJKWKUSB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethoxymethyl)nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethoxymethyl)nonane?
The IUPAC name of 4-(ethoxymethyl)nonane (CID 87066523) is 4-(ethoxymethyl)nonane.
What is the SMILES notation for 4-(ethoxymethyl)nonane?
The canonical SMILES for 4-(ethoxymethyl)nonane is CCCCCC(CCC)COCC.
What is the InChIKey of 4-(ethoxymethyl)nonane?
The InChIKey is NCUQUVAJKWKUSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O/c1-4-7-8-10-12(9-5-2)11-13-6-3/h12H,4-11H2,1-3H3.
What are the key properties of 4-(ethoxymethyl)nonane?
4-(ethoxymethyl)nonane has a molecular weight of 186.34 g/mol, XLogP of 4.02, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethoxymethyl)nonane is sourced from PubChem (CID 87066523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).