About oxirane;4-(2-propylheptoxymethyl)nonane
oxirane;4-(2-propylheptoxymethyl)nonane (PubChem CID 157371001) has the molecular formula C22H46O2
and a molecular weight of 342.61 g/mol. Its IUPAC name is oxirane;4-(2-propylheptoxymethyl)nonane.
Molecular Properties
| Compound Name | oxirane;4-(2-propylheptoxymethyl)nonane |
| PubChem CID | 157371001 |
| Molecular Formula | C22H46O2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.35 |
| IUPAC Name | oxirane;4-(2-propylheptoxymethyl)nonane |
| SMILES | C1CO1.CCCCCC(CCC)COCC(CCC)CCCCC |
| InChI | InChI=1S/C20H42O.C2H4O/c1-5-9-11-15-19(13-7-3)17-21-18-20(14-8-4)16-12-10-6-2;1-2-3-1/h19-20H,5-18H2,1-4H3;1-2H2 |
| InChIKey | BJTLPFMFEFGEJC-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane;4-(2-propylheptoxymethyl)nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane;4-(2-propylheptoxymethyl)nonane?
The IUPAC name of oxirane;4-(2-propylheptoxymethyl)nonane (CID 157371001) is oxirane;4-(2-propylheptoxymethyl)nonane.
What is the SMILES notation for oxirane;4-(2-propylheptoxymethyl)nonane?
The canonical SMILES for oxirane;4-(2-propylheptoxymethyl)nonane is C1CO1.CCCCCC(CCC)COCC(CCC)CCCCC.
What is the InChIKey of oxirane;4-(2-propylheptoxymethyl)nonane?
The InChIKey is BJTLPFMFEFGEJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O.C2H4O/c1-5-9-11-15-19(13-7-3)17-21-18-20(14-8-4)16-12-10-6-2;1-2-3-1/h19-20H,5-18H2,1-4H3;1-2H2.
What are the key properties of oxirane;4-(2-propylheptoxymethyl)nonane?
oxirane;4-(2-propylheptoxymethyl)nonane has a molecular weight of 342.61 g/mol, XLogP of 7.01, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane;4-(2-propylheptoxymethyl)nonane is sourced from PubChem (CID 157371001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).