About acetic acid;3-(ethenoxymethyl)heptane
acetic acid;3-(ethenoxymethyl)heptane (PubChem CID 174888380) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is acetic acid;3-(ethenoxymethyl)heptane.
Molecular Properties
| Compound Name | acetic acid;3-(ethenoxymethyl)heptane |
| PubChem CID | 174888380 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | acetic acid;3-(ethenoxymethyl)heptane |
| SMILES | C=COCC(CC)CCCC.CC(=O)O |
| InChI | InChI=1S/C10H20O.C2H4O2/c1-4-7-8-10(5-2)9-11-6-3;1-2(3)4/h6,10H,3-5,7-9H2,1-2H3;1H3,(H,3,4) |
| InChIKey | UMGTVZZTHAWWQZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;3-(ethenoxymethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-(ethenoxymethyl)heptane?
The IUPAC name of acetic acid;3-(ethenoxymethyl)heptane (CID 174888380) is acetic acid;3-(ethenoxymethyl)heptane.
What is the SMILES notation for acetic acid;3-(ethenoxymethyl)heptane?
The canonical SMILES for acetic acid;3-(ethenoxymethyl)heptane is C=COCC(CC)CCCC.CC(=O)O.
What is the InChIKey of acetic acid;3-(ethenoxymethyl)heptane?
The InChIKey is UMGTVZZTHAWWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C2H4O2/c1-4-7-8-10(5-2)9-11-6-3;1-2(3)4/h6,10H,3-5,7-9H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-(ethenoxymethyl)heptane?
acetic acid;3-(ethenoxymethyl)heptane has a molecular weight of 216.32 g/mol, XLogP of 3.45, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-(ethenoxymethyl)heptane is sourced from PubChem (CID 174888380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).