About 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane
1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane (PubChem CID 158783507) has the molecular formula C20H38O4
and a molecular weight of 342.52 g/mol. Its IUPAC name is 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane.
Molecular Properties
| Compound Name | 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane |
| PubChem CID | 158783507 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane |
| SMILES | C=COCC(C)OCC(C)OC=C.C=COCC(CC)CCCC |
| InChI | InChI=1S/C10H18O3.C10H20O/c1-5-11-7-9(3)13-8-10(4)12-6-2;1-4-7-8-10(5-2)9-11-6-3/h5-6,9-10H,1-2,7-8H2,3-4H3;6,10H,3-5,7-9H2,1-2H3 |
| InChIKey | IRJOPEZDWARTEL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane?
The IUPAC name of 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane (CID 158783507) is 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane.
What is the SMILES notation for 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane?
The canonical SMILES for 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane is C=COCC(C)OCC(C)OC=C.C=COCC(CC)CCCC.
What is the InChIKey of 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane?
The InChIKey is IRJOPEZDWARTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3.C10H20O/c1-5-11-7-9(3)13-8-10(4)12-6-2;1-4-7-8-10(5-2)9-11-6-3/h5-6,9-10H,1-2,7-8H2,3-4H3;6,10H,3-5,7-9H2,1-2H3.
What are the key properties of 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane?
1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane has a molecular weight of 342.52 g/mol, XLogP of 5.46, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-2-(2-ethenoxypropoxy)propane;3-(ethenoxymethyl)heptane is sourced from PubChem (CID 158783507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).