About 5-ethyl-2,2-dimethyltetradecane
5-ethyl-2,2-dimethyltetradecane (PubChem CID 162426700) has the molecular formula C18H38
and a molecular weight of 254.50 g/mol. Its IUPAC name is 5-ethyl-2,2-dimethyltetradecane.
Molecular Properties
| Compound Name | 5-ethyl-2,2-dimethyltetradecane |
| PubChem CID | 162426700 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 5-ethyl-2,2-dimethyltetradecane |
| SMILES | CCCCCCCCCC(CC)CCC(C)(C)C |
| InChI | InChI=1S/C18H38/c1-6-8-9-10-11-12-13-14-17(7-2)15-16-18(3,4)5/h17H,6-16H2,1-5H3 |
| InChIKey | KSWVCLPQCRJBCO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2,2-dimethyltetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,2-dimethyltetradecane?
The IUPAC name of 5-ethyl-2,2-dimethyltetradecane (CID 162426700) is 5-ethyl-2,2-dimethyltetradecane.
What is the SMILES notation for 5-ethyl-2,2-dimethyltetradecane?
The canonical SMILES for 5-ethyl-2,2-dimethyltetradecane is CCCCCCCCCC(CC)CCC(C)(C)C.
What is the InChIKey of 5-ethyl-2,2-dimethyltetradecane?
The InChIKey is KSWVCLPQCRJBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38/c1-6-8-9-10-11-12-13-14-17(7-2)15-16-18(3,4)5/h17H,6-16H2,1-5H3.
What are the key properties of 5-ethyl-2,2-dimethyltetradecane?
5-ethyl-2,2-dimethyltetradecane has a molecular weight of 254.50 g/mol, XLogP of 6.98, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,2-dimethyltetradecane is sourced from PubChem (CID 162426700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).