C13H29NO — CID 118890313
(6S)-6-ethyl-8-methoxy-N,N-dimethyloctan-1-amine (PubChem CID 118890313) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is (6S)-6-ethyl-8-methoxy-N,N-dimethyloctan-1-amine.
| Compound Name | (6S)-6-ethyl-8-methoxy-N,N-dimethyloctan-1-amine |
|---|---|
| PubChem CID | 118890313 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | (6S)-6-ethyl-8-methoxy-N,N-dimethyloctan-1-amine |
| SMILES | CC[C@@H](CCCCCN(C)C)CCOC |
| InChI | InChI=1S/C13H29NO/c1-5-13(10-12-15-4)9-7-6-8-11-14(2)3/h13H,5-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | RWBFWUBWHQBGDF-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|