About 4-ethyl-1,11-dimethoxyundecane
4-ethyl-1,11-dimethoxyundecane (PubChem CID 171750193) has the molecular formula C15H32O2
and a molecular weight of 244.42 g/mol. Its IUPAC name is 4-ethyl-1,11-dimethoxyundecane.
Molecular Properties
| Compound Name | 4-ethyl-1,11-dimethoxyundecane |
| PubChem CID | 171750193 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 4-ethyl-1,11-dimethoxyundecane |
| SMILES | CCC(CCCCCCCOC)CCCOC |
| InChI | InChI=1S/C15H32O2/c1-4-15(12-10-14-17-3)11-8-6-5-7-9-13-16-2/h15H,4-14H2,1-3H3 |
| InChIKey | VOTBGQHCIUMNSR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1,11-dimethoxyundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,11-dimethoxyundecane?
The IUPAC name of 4-ethyl-1,11-dimethoxyundecane (CID 171750193) is 4-ethyl-1,11-dimethoxyundecane.
What is the SMILES notation for 4-ethyl-1,11-dimethoxyundecane?
The canonical SMILES for 4-ethyl-1,11-dimethoxyundecane is CCC(CCCCCCCOC)CCCOC.
What is the InChIKey of 4-ethyl-1,11-dimethoxyundecane?
The InChIKey is VOTBGQHCIUMNSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O2/c1-4-15(12-10-14-17-3)11-8-6-5-7-9-13-16-2/h15H,4-14H2,1-3H3.
What are the key properties of 4-ethyl-1,11-dimethoxyundecane?
4-ethyl-1,11-dimethoxyundecane has a molecular weight of 244.42 g/mol, XLogP of 4.43, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,11-dimethoxyundecane is sourced from PubChem (CID 171750193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).