About 6-bromo-1-methoxyoctane
6-bromo-1-methoxyoctane (PubChem CID 64507402) has the molecular formula C9H19BrO
and a molecular weight of 223.15 g/mol. Its IUPAC name is 6-bromo-1-methoxyoctane.
Molecular Properties
| Compound Name | 6-bromo-1-methoxyoctane |
| PubChem CID | 64507402 |
| Molecular Formula | C9H19BrO |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 6-bromo-1-methoxyoctane |
| SMILES | CCC(Br)CCCCCOC |
| InChI | InChI=1S/C9H19BrO/c1-3-9(10)7-5-4-6-8-11-2/h9H,3-8H2,1-2H3 |
| InChIKey | VZIKVVVVUMSRMC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1-methoxyoctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-methoxyoctane?
The IUPAC name of 6-bromo-1-methoxyoctane (CID 64507402) is 6-bromo-1-methoxyoctane.
What is the SMILES notation for 6-bromo-1-methoxyoctane?
The canonical SMILES for 6-bromo-1-methoxyoctane is CCC(Br)CCCCCOC.
What is the InChIKey of 6-bromo-1-methoxyoctane?
The InChIKey is VZIKVVVVUMSRMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19BrO/c1-3-9(10)7-5-4-6-8-11-2/h9H,3-8H2,1-2H3.
What are the key properties of 6-bromo-1-methoxyoctane?
6-bromo-1-methoxyoctane has a molecular weight of 223.15 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-methoxyoctane is sourced from PubChem (CID 64507402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).