About CID 88797097
CID 88797097 (PubChem CID 88797097) has the molecular formula C16H32Br2CaO
and a molecular weight of 440.32 g/mol.
Molecular Properties
| Compound Name | CID 88797097 |
| PubChem CID | 88797097 |
| Molecular Formula | C16H32Br2CaO |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | — |
| SMILES | CCC(Br)CCCCCOCCCCCC(Br)CC.[Ca] |
| InChI | InChI=1S/C16H32Br2O.Ca/c1-3-15(17)11-7-5-9-13-19-14-10-6-8-12-16(18)4-2;/h15-16H,3-14H2,1-2H3; |
| InChIKey | FPDFCIFIEHDYCE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze CID 88797097 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88797097?
The IUPAC name of CID 88797097 (CID 88797097) is not available.
What is the SMILES notation for CID 88797097?
The canonical SMILES for CID 88797097 is CCC(Br)CCCCCOCCCCCC(Br)CC.[Ca].
What is the InChIKey of CID 88797097?
The InChIKey is FPDFCIFIEHDYCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32Br2O.Ca/c1-3-15(17)11-7-5-9-13-19-14-10-6-8-12-16(18)4-2;/h15-16H,3-14H2,1-2H3;.
What are the key properties of CID 88797097?
CID 88797097 has a molecular weight of 440.32 g/mol, XLogP of 6.09, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88797097 is sourced from PubChem (CID 88797097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).