C19H36CaO4 — CID 56843801
calcium;7,7-dimethyloctanoate;7-methyloctanoate (PubChem CID 56843801) has the molecular formula C19H36CaO4 and a molecular weight of 368.57 g/mol. Its IUPAC name is calcium;7,7-dimethyloctanoate;7-methyloctanoate.
| Compound Name | calcium;7,7-dimethyloctanoate;7-methyloctanoate |
|---|---|
| PubChem CID | 56843801 |
| Molecular Formula | C19H36CaO4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | calcium;7,7-dimethyloctanoate;7-methyloctanoate |
| SMILES | CC(C)(C)CCCCCC(=O)[O-].CC(C)CCCCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C10H20O2.C9H18O2.Ca/c1-10(2,3)8-6-4-5-7-9(11)12;1-8(2)6-4-3-5-7-9(10)11;/h4-8H2,1-3H3,(H,11,12);8H,3-7H2,1-2H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | BFVRVRCVTBJVJQ-UHFFFAOYSA-L |
| XLogP | 2.69 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|