C20H38MnO4 — CID 22315822
bis(7,7-dimethyloctanoate);manganese(2+) (PubChem CID 22315822) has the molecular formula C20H38MnO4 and a molecular weight of 397.46 g/mol. Its IUPAC name is bis(7,7-dimethyloctanoate);manganese(2+).
| Compound Name | bis(7,7-dimethyloctanoate);manganese(2+) |
|---|---|
| PubChem CID | 22315822 |
| Molecular Formula | C20H38MnO4 |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | bis(7,7-dimethyloctanoate);manganese(2+) |
| SMILES | CC(C)(C)CCCCCC(=O)[O-].CC(C)(C)CCCCCC(=O)[O-].[Mn+2] |
| InChI | InChI=1S/2C10H20O2.Mn/c2*1-10(2,3)8-6-4-5-7-9(11)12;/h2*4-8H2,1-3H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | BDPWLKPVAKYQNL-UHFFFAOYSA-L |
| XLogP | 3.46 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|