C20H40O4Sn — CID 160545189
bis(6,6-dimethylheptanoate);dimethyltin(2+) (PubChem CID 160545189) has the molecular formula C20H40O4Sn and a molecular weight of 463.25 g/mol. Its IUPAC name is bis(6,6-dimethylheptanoate);dimethyltin(2+).
| Compound Name | bis(6,6-dimethylheptanoate);dimethyltin(2+) |
|---|---|
| PubChem CID | 160545189 |
| Molecular Formula | C20H40O4Sn |
| Molecular Weight | 463.25 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | bis(6,6-dimethylheptanoate);dimethyltin(2+) |
| SMILES | CC(C)(C)CCCCC(=O)[O-].CC(C)(C)CCCCC(=O)[O-].C[Sn+2]C |
| InChI | InChI=1S/2C9H18O2.2CH3.Sn/c2*1-9(2,3)7-5-4-6-8(10)11;;;/h2*4-7H2,1-3H3,(H,10,11);2*1H3;/q;;;;+2/p-2 |
| InChIKey | QXIGCTLXUNKMIB-UHFFFAOYSA-L |
| XLogP | 3.47 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|