C20H38CaO4 — CID 56844065
calcium;6,6-dimethylheptanoate;8,8-dimethylnonanoate (PubChem CID 56844065) has the molecular formula C20H38CaO4 and a molecular weight of 382.60 g/mol. Its IUPAC name is calcium;6,6-dimethylheptanoate;8,8-dimethylnonanoate.
| Compound Name | calcium;6,6-dimethylheptanoate;8,8-dimethylnonanoate |
|---|---|
| PubChem CID | 56844065 |
| Molecular Formula | C20H38CaO4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | calcium;6,6-dimethylheptanoate;8,8-dimethylnonanoate |
| SMILES | CC(C)(C)CCCCC(=O)[O-].CC(C)(C)CCCCCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C11H22O2.C9H18O2.Ca/c1-11(2,3)9-7-5-4-6-8-10(12)13;1-9(2,3)7-5-4-6-8(10)11;/h4-9H2,1-3H3,(H,12,13);4-7H2,1-3H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | NWKDRBNPBFVGSQ-UHFFFAOYSA-L |
| XLogP | 3.09 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|