C10H19BNbO5-4 — CID 175224154
7,7-dimethyloctanoate;niobium;borate (PubChem CID 175224154) has the molecular formula C10H19BNbO5-4 and a molecular weight of 322.98 g/mol. Its IUPAC name is 7,7-dimethyloctanoate;niobium;borate.
| Compound Name | 7,7-dimethyloctanoate;niobium;borate |
|---|---|
| PubChem CID | 175224154 |
| Molecular Formula | C10H19BNbO5-4 |
| Molecular Weight | 322.98 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 7,7-dimethyloctanoate;niobium;borate |
| SMILES | CC(C)(C)CCCCCC(=O)[O-].[Nb].[O-]B([O-])[O-] |
| InChI | InChI=1S/C10H20O2.BO3.Nb/c1-10(2,3)8-6-4-5-7-9(11)12;2-1(3)4;/h4-8H2,1-3H3,(H,11,12);;/q;-3;/p-1 |
| InChIKey | HTVRDBAQGSZJPB-UHFFFAOYSA-M |
| XLogP | -2.22 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.98 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|