About dizinc;octadecanoate;borate
dizinc;octadecanoate;borate (PubChem CID 161089175) has the molecular formula C18H35BO5Zn2
and a molecular weight of 473.07 g/mol. Its IUPAC name is dizinc;octadecanoate;borate.
Molecular Properties
| Compound Name | dizinc;octadecanoate;borate |
| PubChem CID | 161089175 |
| Molecular Formula | C18H35BO5Zn2 |
| Molecular Weight | 473.07 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | dizinc;octadecanoate;borate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].[O-]B([O-])[O-].[Zn+2].[Zn+2] |
| InChI | InChI=1S/C18H36O2.BO3.2Zn/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4;;/h2-17H2,1H3,(H,19,20);;;/q;-3;2*+2/p-1 |
| InChIKey | UGYBJUUCEHZGSB-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.07 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dizinc;octadecanoate;borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dizinc;octadecanoate;borate?
The IUPAC name of dizinc;octadecanoate;borate (CID 161089175) is dizinc;octadecanoate;borate.
What is the SMILES notation for dizinc;octadecanoate;borate?
The canonical SMILES for dizinc;octadecanoate;borate is CCCCCCCCCCCCCCCCCC(=O)[O-].[O-]B([O-])[O-].[Zn+2].[Zn+2].
What is the InChIKey of dizinc;octadecanoate;borate?
The InChIKey is UGYBJUUCEHZGSB-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.BO3.2Zn/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4;;/h2-17H2,1H3,(H,19,20);;;/q;-3;2*+2/p-1.
What are the key properties of dizinc;octadecanoate;borate?
dizinc;octadecanoate;borate has a molecular weight of 473.07 g/mol, XLogP of 1.04, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dizinc;octadecanoate;borate is sourced from PubChem (CID 161089175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).