About copper;hexadecanoate;borate
copper;hexadecanoate;borate (PubChem CID 175224143) has the molecular formula C16H31BCuO5-4
and a molecular weight of 377.78 g/mol. Its IUPAC name is copper;hexadecanoate;borate.
Molecular Properties
| Compound Name | copper;hexadecanoate;borate |
| PubChem CID | 175224143 |
| Molecular Formula | C16H31BCuO5-4 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | copper;hexadecanoate;borate |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].[Cu].[O-]B([O-])[O-] |
| InChI | InChI=1S/C16H32O2.BO3.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;2-1(3)4;/h2-15H2,1H3,(H,17,18);;/q;-3;/p-1 |
| InChIKey | JXLWDFMDIOFXNK-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze copper;hexadecanoate;borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;hexadecanoate;borate?
The IUPAC name of copper;hexadecanoate;borate (CID 175224143) is copper;hexadecanoate;borate.
What is the SMILES notation for copper;hexadecanoate;borate?
The canonical SMILES for copper;hexadecanoate;borate is CCCCCCCCCCCCCCCC(=O)[O-].[Cu].[O-]B([O-])[O-].
What is the InChIKey of copper;hexadecanoate;borate?
The InChIKey is JXLWDFMDIOFXNK-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H32O2.BO3.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;2-1(3)4;/h2-15H2,1H3,(H,17,18);;/q;-3;/p-1.
What are the key properties of copper;hexadecanoate;borate?
copper;hexadecanoate;borate has a molecular weight of 377.78 g/mol, XLogP of 0.27, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for copper;hexadecanoate;borate is sourced from PubChem (CID 175224143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).