C15H28MnO4 — CID 23469993
4,4-dimethylpentanoate;manganese(2+);6-methylheptanoate (PubChem CID 23469993) has the molecular formula C15H28MnO4 and a molecular weight of 327.32 g/mol. Its IUPAC name is 4,4-dimethylpentanoate;manganese(2+);6-methylheptanoate.
| Compound Name | 4,4-dimethylpentanoate;manganese(2+);6-methylheptanoate |
|---|---|
| PubChem CID | 23469993 |
| Molecular Formula | C15H28MnO4 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 4,4-dimethylpentanoate;manganese(2+);6-methylheptanoate |
| SMILES | CC(C)(C)CCC(=O)[O-].CC(C)CCCCC(=O)[O-].[Mn+2] |
| InChI | InChI=1S/C8H16O2.C7H14O2.Mn/c1-7(2)5-3-4-6-8(9)10;1-7(2,3)5-4-6(8)9;/h7H,3-6H2,1-2H3,(H,9,10);4-5H2,1-3H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | WVFHZCNASSSJJD-UHFFFAOYSA-L |
| XLogP | 1.51 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|