About antimony(3+);decanoate;bis(6-methylheptanoate)
antimony(3+);decanoate;bis(6-methylheptanoate) (PubChem CID 20517200) has the molecular formula C26H49O6Sb
and a molecular weight of 579.43 g/mol. Its IUPAC name is antimony(3+);decanoate;bis(6-methylheptanoate).
Molecular Properties
| Compound Name | antimony(3+);decanoate;bis(6-methylheptanoate) |
| PubChem CID | 20517200 |
| Molecular Formula | C26H49O6Sb |
| Molecular Weight | 579.43 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | antimony(3+);decanoate;bis(6-methylheptanoate) |
| SMILES | CC(C)CCCCC(=O)[O-].CC(C)CCCCC(=O)[O-].CCCCCCCCCC(=O)[O-].[Sb+3] |
| InChI | InChI=1S/C10H20O2.2C8H16O2.Sb/c1-2-3-4-5-6-7-8-9-10(11)12;2*1-7(2)5-3-4-6-8(9)10;/h2-9H2,1H3,(H,11,12);2*7H,3-6H2,1-2H3,(H,9,10);/q;;;+3/p-3 |
| InChIKey | WNAJQUGQRJRBGC-UHFFFAOYSA-K |
| XLogP | 3.40 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 579.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze antimony(3+);decanoate;bis(6-methylheptanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of antimony(3+);decanoate;bis(6-methylheptanoate)?
The IUPAC name of antimony(3+);decanoate;bis(6-methylheptanoate) (CID 20517200) is antimony(3+);decanoate;bis(6-methylheptanoate).
What is the SMILES notation for antimony(3+);decanoate;bis(6-methylheptanoate)?
The canonical SMILES for antimony(3+);decanoate;bis(6-methylheptanoate) is CC(C)CCCCC(=O)[O-].CC(C)CCCCC(=O)[O-].CCCCCCCCCC(=O)[O-].[Sb+3].
What is the InChIKey of antimony(3+);decanoate;bis(6-methylheptanoate)?
The InChIKey is WNAJQUGQRJRBGC-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H20O2.2C8H16O2.Sb/c1-2-3-4-5-6-7-8-9-10(11)12;2*1-7(2)5-3-4-6-8(9)10;/h2-9H2,1H3,(H,11,12);2*7H,3-6H2,1-2H3,(H,9,10);/q;;;+3/p-3.
What are the key properties of antimony(3+);decanoate;bis(6-methylheptanoate)?
antimony(3+);decanoate;bis(6-methylheptanoate) has a molecular weight of 579.43 g/mol, XLogP of 3.40, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for antimony(3+);decanoate;bis(6-methylheptanoate) is sourced from PubChem (CID 20517200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).