About aluminum;bis(2-methylpropan-1-olate);octadecanoate
aluminum;bis(2-methylpropan-1-olate);octadecanoate (PubChem CID 102269418) has the molecular formula C26H53AlO4
and a molecular weight of 456.69 g/mol. Its IUPAC name is aluminum;bis(2-methylpropan-1-olate);octadecanoate.
Molecular Properties
| Compound Name | aluminum;bis(2-methylpropan-1-olate);octadecanoate |
| PubChem CID | 102269418 |
| Molecular Formula | C26H53AlO4 |
| Molecular Weight | 456.69 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | aluminum;bis(2-methylpropan-1-olate);octadecanoate |
| SMILES | CC(C)C[O-].CC(C)C[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Al+3] |
| InChI | InChI=1S/C18H36O2.2C4H9O.Al/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-4(2)3-5;/h2-17H2,1H3,(H,19,20);2*4H,3H2,1-2H3;/q;2*-1;+3/p-1 |
| InChIKey | KQNHWOYDKAQGIM-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze aluminum;bis(2-methylpropan-1-olate);octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;bis(2-methylpropan-1-olate);octadecanoate?
The IUPAC name of aluminum;bis(2-methylpropan-1-olate);octadecanoate (CID 102269418) is aluminum;bis(2-methylpropan-1-olate);octadecanoate.
What is the SMILES notation for aluminum;bis(2-methylpropan-1-olate);octadecanoate?
The canonical SMILES for aluminum;bis(2-methylpropan-1-olate);octadecanoate is CC(C)C[O-].CC(C)C[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Al+3].
What is the InChIKey of aluminum;bis(2-methylpropan-1-olate);octadecanoate?
The InChIKey is KQNHWOYDKAQGIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.2C4H9O.Al/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-4(2)3-5;/h2-17H2,1H3,(H,19,20);2*4H,3H2,1-2H3;/q;2*-1;+3/p-1.
What are the key properties of aluminum;bis(2-methylpropan-1-olate);octadecanoate?
aluminum;bis(2-methylpropan-1-olate);octadecanoate has a molecular weight of 456.69 g/mol, XLogP of 4.62, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;bis(2-methylpropan-1-olate);octadecanoate is sourced from PubChem (CID 102269418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).