C23H48O — CID 139372229
1-(3,7-dimethyloctoxy)-10,10-dimethylundecane (PubChem CID 139372229) has the molecular formula C23H48O and a molecular weight of 340.64 g/mol. Its IUPAC name is 1-(3,7-dimethyloctoxy)-10,10-dimethylundecane.
| Compound Name | 1-(3,7-dimethyloctoxy)-10,10-dimethylundecane |
|---|---|
| PubChem CID | 139372229 |
| Molecular Formula | C23H48O |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.37 |
| IUPAC Name | 1-(3,7-dimethyloctoxy)-10,10-dimethylundecane |
| SMILES | CC(C)CCCC(C)CCOCCCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C23H48O/c1-21(2)15-14-16-22(3)17-20-24-19-13-11-9-7-8-10-12-18-23(4,5)6/h21-22H,7-20H2,1-6H3 |
| InChIKey | RZHPPGBQXINRJH-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|