C28H58O — CID 126578390
1-(3,3-dimethylbutoxy)-3,7,11,15-tetramethyloctadecane (PubChem CID 126578390) has the molecular formula C28H58O and a molecular weight of 410.77 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxy)-3,7,11,15-tetramethyloctadecane.
| Compound Name | 1-(3,3-dimethylbutoxy)-3,7,11,15-tetramethyloctadecane |
|---|---|
| PubChem CID | 126578390 |
| Molecular Formula | C28H58O |
| Molecular Weight | 410.77 g/mol |
| Exact Mass | 410.45 |
| IUPAC Name | 1-(3,3-dimethylbutoxy)-3,7,11,15-tetramethyloctadecane |
| SMILES | CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCOCCC(C)(C)C |
| InChI | InChI=1S/C28H58O/c1-9-13-24(2)14-10-15-25(3)16-11-17-26(4)18-12-19-27(5)20-22-29-23-21-28(6,7)8/h24-27H,9-23H2,1-8H3 |
| InChIKey | ZBICHUOEZMEAHB-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.77 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|