C20H40O2 — CID 162957304
(3R,4R,7S,11S)-3,7,11,15-tetramethylhexadec-1-ene-3,4-diol (PubChem CID 162957304) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is (3R,4R,7S,11S)-3,7,11,15-tetramethylhexadec-1-ene-3,4-diol.
| Compound Name | (3R,4R,7S,11S)-3,7,11,15-tetramethylhexadec-1-ene-3,4-diol |
|---|---|
| PubChem CID | 162957304 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | (3R,4R,7S,11S)-3,7,11,15-tetramethylhexadec-1-ene-3,4-diol |
| SMILES | C=C[C@@](C)(O)[C@H](O)CC[C@@H](C)CCC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H40O2/c1-7-20(6,22)19(21)15-14-18(5)13-9-12-17(4)11-8-10-16(2)3/h7,16-19,21-22H,1,8-15H2,2-6H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | AIGNAKDHCZHHSV-VNTMZGSJSA-N |
| XLogP | 5.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|