C23H50O5 — CID 174613323
propane-1,2-diol;3,7,11,15-tetramethylhexadecane-1,1,1-triol (PubChem CID 174613323) has the molecular formula C23H50O5 and a molecular weight of 406.65 g/mol. Its IUPAC name is propane-1,2-diol;3,7,11,15-tetramethylhexadecane-1,1,1-triol.
| Compound Name | propane-1,2-diol;3,7,11,15-tetramethylhexadecane-1,1,1-triol |
|---|---|
| PubChem CID | 174613323 |
| Molecular Formula | C23H50O5 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.37 |
| IUPAC Name | propane-1,2-diol;3,7,11,15-tetramethylhexadecane-1,1,1-triol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(O)(O)O.CC(O)CO |
| InChI | InChI=1S/C20H42O3.C3H8O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21,22)23;1-3(5)2-4/h16-19,21-23H,6-15H2,1-5H3;3-5H,2H2,1H3 |
| InChIKey | CBLWYZGOHQTRFW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|