C43H88O3 — CID 23400782
(2S)-6,10,14,18-tetramethyl-3-(3,7,11,15-tetramethylhexadecyl)nonadecane-1,2,3-triol (PubChem CID 23400782) has the molecular formula C43H88O3 and a molecular weight of 653.17 g/mol. Its IUPAC name is (2S)-6,10,14,18-tetramethyl-3-(3,7,11,15-tetramethylhexadecyl)nonadecane-1,2,3-triol.
| Compound Name | (2S)-6,10,14,18-tetramethyl-3-(3,7,11,15-tetramethylhexadecyl)nonadecane-1,2,3-triol |
|---|---|
| PubChem CID | 23400782 |
| Molecular Formula | C43H88O3 |
| Molecular Weight | 653.17 g/mol |
| Exact Mass | 652.67 |
| IUPAC Name | (2S)-6,10,14,18-tetramethyl-3-(3,7,11,15-tetramethylhexadecyl)nonadecane-1,2,3-triol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCC(O)(CCC(C)CCCC(C)CCCC(C)CCCC(C)C)[C@@H](O)CO |
| InChI | InChI=1S/C43H88O3/c1-34(2)17-11-19-36(5)21-13-23-38(7)25-15-27-40(9)29-31-43(46,42(45)33-44)32-30-41(10)28-16-26-39(8)24-14-22-37(6)20-12-18-35(3)4/h34-42,44-46H,11-33H2,1-10H3/t36?,37?,38?,39?,40?,41?,42-,43?/m0/s1 |
| InChIKey | VJLPMEKWQRLJRI-WGSOMVNASA-N |
| XLogP | 12.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.17 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |