C14H30S3 — CID 11748439
4,8-dimethyl-1,1,1-tris(methylsulfanyl)nonane (PubChem CID 11748439) has the molecular formula C14H30S3 and a molecular weight of 294.59 g/mol. Its IUPAC name is 4,8-dimethyl-1,1,1-tris(methylsulfanyl)nonane.
| Compound Name | 4,8-dimethyl-1,1,1-tris(methylsulfanyl)nonane |
|---|---|
| PubChem CID | 11748439 |
| Molecular Formula | C14H30S3 |
| Molecular Weight | 294.59 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4,8-dimethyl-1,1,1-tris(methylsulfanyl)nonane |
| SMILES | CSC(CCC(C)CCCC(C)C)(SC)SC |
| InChI | InChI=1S/C14H30S3/c1-12(2)8-7-9-13(3)10-11-14(15-4,16-5)17-6/h12-13H,7-11H2,1-6H3 |
| InChIKey | DTNXXWXFIUVTIS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|