C20H43Ga — CID 174707879
3,7,11,15-tetramethylhexadecylgallane (PubChem CID 174707879) has the molecular formula C20H43Ga and a molecular weight of 353.29 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadecylgallane.
| Compound Name | 3,7,11,15-tetramethylhexadecylgallane |
|---|---|
| PubChem CID | 174707879 |
| Molecular Formula | C20H43Ga |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 3,7,11,15-tetramethylhexadecylgallane |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC[GaH2] |
| InChI | InChI=1S/C20H41.Ga.2H/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3;;;/h17-20H,1,7-16H2,2-6H3;;; |
| InChIKey | VOHSLRULPNSSBE-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |