C25H50 — CID 123901868
10-ethyl-5,16,18-trimethylicos-2-ene (PubChem CID 123901868) has the molecular formula C25H50 and a molecular weight of 350.68 g/mol. Its IUPAC name is 10-ethyl-5,16,18-trimethylicos-2-ene.
| Compound Name | 10-ethyl-5,16,18-trimethylicos-2-ene |
|---|---|
| PubChem CID | 123901868 |
| Molecular Formula | C25H50 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.39 |
| IUPAC Name | 10-ethyl-5,16,18-trimethylicos-2-ene |
| SMILES | CC=CCC(C)CCCCC(CC)CCCCCC(C)CC(C)CC |
| InChI | InChI=1S/C25H50/c1-7-10-16-23(5)17-14-15-20-25(9-3)19-13-11-12-18-24(6)21-22(4)8-2/h7,10,22-25H,8-9,11-21H2,1-6H3 |
| InChIKey | FXSYOJDYTUTOHA-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|