About carbanide;3,5-dimethyldodecane;yttrium
carbanide;3,5-dimethyldodecane;yttrium (PubChem CID 58340734) has the molecular formula C15H32Y-2
and a molecular weight of 301.33 g/mol. Its IUPAC name is carbanide;3,5-dimethyldodecane;yttrium.
Molecular Properties
| Compound Name | carbanide;3,5-dimethyldodecane;yttrium |
| PubChem CID | 58340734 |
| Molecular Formula | C15H32Y-2 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | carbanide;3,5-dimethyldodecane;yttrium |
| SMILES | C[CH-]CCCCCC(C)CC(C)CC.[CH3-].[Y] |
| InChI | InChI=1S/C14H29.CH3.Y/c1-5-7-8-9-10-11-14(4)12-13(3)6-2;;/h5,13-14H,6-12H2,1-4H3;1H3;/q2*-1; |
| InChIKey | LRUYXMRVHHPPPP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;3,5-dimethyldodecane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;3,5-dimethyldodecane;yttrium?
The IUPAC name of carbanide;3,5-dimethyldodecane;yttrium (CID 58340734) is carbanide;3,5-dimethyldodecane;yttrium.
What is the SMILES notation for carbanide;3,5-dimethyldodecane;yttrium?
The canonical SMILES for carbanide;3,5-dimethyldodecane;yttrium is C[CH-]CCCCCC(C)CC(C)CC.[CH3-].[Y].
What is the InChIKey of carbanide;3,5-dimethyldodecane;yttrium?
The InChIKey is LRUYXMRVHHPPPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29.CH3.Y/c1-5-7-8-9-10-11-14(4)12-13(3)6-2;;/h5,13-14H,6-12H2,1-4H3;1H3;/q2*-1;.
What are the key properties of carbanide;3,5-dimethyldodecane;yttrium?
carbanide;3,5-dimethyldodecane;yttrium has a molecular weight of 301.33 g/mol, XLogP of 5.68, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;3,5-dimethyldodecane;yttrium is sourced from PubChem (CID 58340734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).