About carbanide;3,11-dimethyltetradecane;yttrium
carbanide;3,11-dimethyltetradecane;yttrium (PubChem CID 58340688) has the molecular formula C17H36Y-2
and a molecular weight of 329.38 g/mol. Its IUPAC name is carbanide;3,11-dimethyltetradecane;yttrium.
Molecular Properties
| Compound Name | carbanide;3,11-dimethyltetradecane;yttrium |
| PubChem CID | 58340688 |
| Molecular Formula | C17H36Y-2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | carbanide;3,11-dimethyltetradecane;yttrium |
| SMILES | C[CH-]CC(C)CCCCCCCC(C)CC.[CH3-].[Y] |
| InChI | InChI=1S/C16H33.CH3.Y/c1-5-12-16(4)14-11-9-7-8-10-13-15(3)6-2;;/h5,15-16H,6-14H2,1-4H3;1H3;/q2*-1; |
| InChIKey | UIKCJBXQYBXSMS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;3,11-dimethyltetradecane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;3,11-dimethyltetradecane;yttrium?
The IUPAC name of carbanide;3,11-dimethyltetradecane;yttrium (CID 58340688) is carbanide;3,11-dimethyltetradecane;yttrium.
What is the SMILES notation for carbanide;3,11-dimethyltetradecane;yttrium?
The canonical SMILES for carbanide;3,11-dimethyltetradecane;yttrium is C[CH-]CC(C)CCCCCCCC(C)CC.[CH3-].[Y].
What is the InChIKey of carbanide;3,11-dimethyltetradecane;yttrium?
The InChIKey is UIKCJBXQYBXSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33.CH3.Y/c1-5-12-16(4)14-11-9-7-8-10-13-15(3)6-2;;/h5,15-16H,6-14H2,1-4H3;1H3;/q2*-1;.
What are the key properties of carbanide;3,11-dimethyltetradecane;yttrium?
carbanide;3,11-dimethyltetradecane;yttrium has a molecular weight of 329.38 g/mol, XLogP of 6.46, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;3,11-dimethyltetradecane;yttrium is sourced from PubChem (CID 58340688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).